C18H34O2 — CID 151507432
(1-cyclopropyl-1,1-dimethoxydecan-2-yl)cyclopropane (PubChem CID 151507432) has the molecular formula C18H34O2 and a molecular weight of 282.47 g/mol. Its IUPAC name is (1-cyclopropyl-1,1-dimethoxydecan-2-yl)cyclopropane.
| Compound Name | (1-cyclopropyl-1,1-dimethoxydecan-2-yl)cyclopropane |
|---|---|
| PubChem CID | 151507432 |
| Molecular Formula | C18H34O2 |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.26 |
| IUPAC Name | (1-cyclopropyl-1,1-dimethoxydecan-2-yl)cyclopropane |
| SMILES | CCCCCCCCC(C1CC1)C(OC)(OC)C1CC1 |
| InChI | InChI=1S/C18H34O2/c1-4-5-6-7-8-9-10-17(15-11-12-15)18(19-2,20-3)16-13-14-16/h15-17H,4-14H2,1-3H3 |
| InChIKey | PRSNOUBISYABAW-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|