C24H44O3 — CID 150250657
5-[1,1,1-tri(propan-2-yloxy)decan-2-yl]cyclopenta-1,3-diene (PubChem CID 150250657) has the molecular formula C24H44O3 and a molecular weight of 380.61 g/mol. Its IUPAC name is 5-[1,1,1-tri(propan-2-yloxy)decan-2-yl]cyclopenta-1,3-diene.
| Compound Name | 5-[1,1,1-tri(propan-2-yloxy)decan-2-yl]cyclopenta-1,3-diene |
|---|---|
| PubChem CID | 150250657 |
| Molecular Formula | C24H44O3 |
| Molecular Weight | 380.61 g/mol |
| Exact Mass | 380.33 |
| IUPAC Name | 5-[1,1,1-tri(propan-2-yloxy)decan-2-yl]cyclopenta-1,3-diene |
| SMILES | CCCCCCCCC(C1C=CC=C1)C(OC(C)C)(OC(C)C)OC(C)C |
| InChI | InChI=1S/C24H44O3/c1-8-9-10-11-12-13-18-23(22-16-14-15-17-22)24(25-19(2)3,26-20(4)5)27-21(6)7/h14-17,19-23H,8-13,18H2,1-7H3 |
| InChIKey | FZLWKTCABDFPEP-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.61 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|