C21H33F3O3 — CID 150331414
1-(1,1-dimethoxy-1-propan-2-yloxydecan-2-yl)-2,4,5-trifluorobenzene (PubChem CID 150331414) has the molecular formula C21H33F3O3 and a molecular weight of 390.49 g/mol. Its IUPAC name is 1-(1,1-dimethoxy-1-propan-2-yloxydecan-2-yl)-2,4,5-trifluorobenzene.
| Compound Name | 1-(1,1-dimethoxy-1-propan-2-yloxydecan-2-yl)-2,4,5-trifluorobenzene |
|---|---|
| PubChem CID | 150331414 |
| Molecular Formula | C21H33F3O3 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | 1-(1,1-dimethoxy-1-propan-2-yloxydecan-2-yl)-2,4,5-trifluorobenzene |
| SMILES | CCCCCCCCC(c1cc(F)c(F)cc1F)C(OC)(OC)OC(C)C |
| InChI | InChI=1S/C21H33F3O3/c1-6-7-8-9-10-11-12-17(21(25-4,26-5)27-15(2)3)16-13-19(23)20(24)14-18(16)22/h13-15,17H,6-12H2,1-5H3 |
| InChIKey | GPTGLBPSJDUITM-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|