C25H40F4O3 — CID 151165053
1,2,3,4-tetrafluoro-5-(1,1,1-tripropoxydecan-2-yl)benzene (PubChem CID 151165053) has the molecular formula C25H40F4O3 and a molecular weight of 464.58 g/mol. Its IUPAC name is 1,2,3,4-tetrafluoro-5-(1,1,1-tripropoxydecan-2-yl)benzene.
| Compound Name | 1,2,3,4-tetrafluoro-5-(1,1,1-tripropoxydecan-2-yl)benzene |
|---|---|
| PubChem CID | 151165053 |
| Molecular Formula | C25H40F4O3 |
| Molecular Weight | 464.58 g/mol |
| Exact Mass | 464.29 |
| IUPAC Name | 1,2,3,4-tetrafluoro-5-(1,1,1-tripropoxydecan-2-yl)benzene |
| SMILES | CCCCCCCCC(c1cc(F)c(F)c(F)c1F)C(OCCC)(OCCC)OCCC |
| InChI | InChI=1S/C25H40F4O3/c1-5-9-10-11-12-13-14-20(19-18-21(26)23(28)24(29)22(19)27)25(30-15-6-2,31-16-7-3)32-17-8-4/h18,20H,5-17H2,1-4H3 |
| InChIKey | NBBMZFFHJSTGDM-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.58 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|