C32H47F3O3 — CID 150605079
1-(trifluoromethyl)-3-[4-(1,1,1-tripropoxydecan-2-yl)phenyl]benzene (PubChem CID 150605079) has the molecular formula C32H47F3O3 and a molecular weight of 536.72 g/mol. Its IUPAC name is 1-(trifluoromethyl)-3-[4-(1,1,1-tripropoxydecan-2-yl)phenyl]benzene.
| Compound Name | 1-(trifluoromethyl)-3-[4-(1,1,1-tripropoxydecan-2-yl)phenyl]benzene |
|---|---|
| PubChem CID | 150605079 |
| Molecular Formula | C32H47F3O3 |
| Molecular Weight | 536.72 g/mol |
| Exact Mass | 536.35 |
| IUPAC Name | 1-(trifluoromethyl)-3-[4-(1,1,1-tripropoxydecan-2-yl)phenyl]benzene |
| SMILES | CCCCCCCCC(c1ccc(-c2cccc(C(F)(F)F)c2)cc1)C(OCCC)(OCCC)OCCC |
| InChI | InChI=1S/C32H47F3O3/c1-5-9-10-11-12-13-17-30(32(36-22-6-2,37-23-7-3)38-24-8-4)27-20-18-26(19-21-27)28-15-14-16-29(25-28)31(33,34)35/h14-16,18-21,25,30H,5-13,17,22-24H2,1-4H3 |
| InChIKey | ISRWFHXFCONABJ-UHFFFAOYSA-N |
| XLogP | 10.14 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.72 |
| LogP ≤ 5 | 10.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|