C22H37ClO3 — CID 151553765
1-chloro-4-(1,1,1-triethoxydecan-2-yl)benzene (PubChem CID 151553765) has the molecular formula C22H37ClO3 and a molecular weight of 384.99 g/mol. Its IUPAC name is 1-chloro-4-(1,1,1-triethoxydecan-2-yl)benzene.
| Compound Name | 1-chloro-4-(1,1,1-triethoxydecan-2-yl)benzene |
|---|---|
| PubChem CID | 151553765 |
| Molecular Formula | C22H37ClO3 |
| Molecular Weight | 384.99 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | 1-chloro-4-(1,1,1-triethoxydecan-2-yl)benzene |
| SMILES | CCCCCCCCC(c1ccc(Cl)cc1)C(OCC)(OCC)OCC |
| InChI | InChI=1S/C22H37ClO3/c1-5-9-10-11-12-13-14-21(19-15-17-20(23)18-16-19)22(24-6-2,25-7-3)26-8-4/h15-18,21H,5-14H2,1-4H3 |
| InChIKey | QBANVSKUYXLSII-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.99 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|