C31H49F5O3 — CID 151748375
1,2,3,4,5-pentafluoro-6-[4-(1,1,1-tripropoxydecan-2-yl)cyclohexyl]benzene (PubChem CID 151748375) has the molecular formula C31H49F5O3 and a molecular weight of 564.72 g/mol. Its IUPAC name is 1,2,3,4,5-pentafluoro-6-[4-(1,1,1-tripropoxydecan-2-yl)cyclohexyl]benzene.
| Compound Name | 1,2,3,4,5-pentafluoro-6-[4-(1,1,1-tripropoxydecan-2-yl)cyclohexyl]benzene |
|---|---|
| PubChem CID | 151748375 |
| Molecular Formula | C31H49F5O3 |
| Molecular Weight | 564.72 g/mol |
| Exact Mass | 564.36 |
| IUPAC Name | 1,2,3,4,5-pentafluoro-6-[4-(1,1,1-tripropoxydecan-2-yl)cyclohexyl]benzene |
| SMILES | CCCCCCCCC(C1CCC(c2c(F)c(F)c(F)c(F)c2F)CC1)C(OCCC)(OCCC)OCCC |
| InChI | InChI=1S/C31H49F5O3/c1-5-9-10-11-12-13-14-24(31(37-19-6-2,38-20-7-3)39-21-8-4)22-15-17-23(18-16-22)25-26(32)28(34)30(36)29(35)27(25)33/h22-24H,5-21H2,1-4H3 |
| InChIKey | RNZNJXSKNSJUNH-UHFFFAOYSA-N |
| XLogP | 9.96 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.72 |
| LogP ≤ 5 | 9.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|