C26H39F5O3 — CID 150232796
1-[4-[2-(1,1-dimethoxydecoxy)ethyl]cyclohexyl]-2,3,4,5,6-pentafluorobenzene (PubChem CID 150232796) has the molecular formula C26H39F5O3 and a molecular weight of 494.59 g/mol. Its IUPAC name is 1-[4-[2-(1,1-dimethoxydecoxy)ethyl]cyclohexyl]-2,3,4,5,6-pentafluorobenzene.
| Compound Name | 1-[4-[2-(1,1-dimethoxydecoxy)ethyl]cyclohexyl]-2,3,4,5,6-pentafluorobenzene |
|---|---|
| PubChem CID | 150232796 |
| Molecular Formula | C26H39F5O3 |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 494.28 |
| IUPAC Name | 1-[4-[2-(1,1-dimethoxydecoxy)ethyl]cyclohexyl]-2,3,4,5,6-pentafluorobenzene |
| SMILES | CCCCCCCCCC(OC)(OC)OCCC1CCC(c2c(F)c(F)c(F)c(F)c2F)CC1 |
| InChI | InChI=1S/C26H39F5O3/c1-4-5-6-7-8-9-10-16-26(32-2,33-3)34-17-15-18-11-13-19(14-12-18)20-21(27)23(29)25(31)24(30)22(20)28/h18-19H,4-17H2,1-3H3 |
| InChIKey | FVVORZBSHDUBIG-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|