C29H45F5O3 — CID 151665668
1-[3-[1-[di(propan-2-yloxy)methoxy]decyl]cyclohexyl]-2,3,4,5,6-pentafluorobenzene (PubChem CID 151665668) has the molecular formula C29H45F5O3 and a molecular weight of 536.67 g/mol. Its IUPAC name is 1-[3-[1-[di(propan-2-yloxy)methoxy]decyl]cyclohexyl]-2,3,4,5,6-pentafluorobenzene.
| Compound Name | 1-[3-[1-[di(propan-2-yloxy)methoxy]decyl]cyclohexyl]-2,3,4,5,6-pentafluorobenzene |
|---|---|
| PubChem CID | 151665668 |
| Molecular Formula | C29H45F5O3 |
| Molecular Weight | 536.67 g/mol |
| Exact Mass | 536.33 |
| IUPAC Name | 1-[3-[1-[di(propan-2-yloxy)methoxy]decyl]cyclohexyl]-2,3,4,5,6-pentafluorobenzene |
| SMILES | CCCCCCCCCC(OC(OC(C)C)OC(C)C)C1CCCC(c2c(F)c(F)c(F)c(F)c2F)C1 |
| InChI | InChI=1S/C29H45F5O3/c1-6-7-8-9-10-11-12-16-22(37-29(35-18(2)3)36-19(4)5)20-14-13-15-21(17-20)23-24(30)26(32)28(34)27(33)25(23)31/h18-22,29H,6-17H2,1-5H3 |
| InChIKey | QXMBDDQPJHEHBJ-UHFFFAOYSA-N |
| XLogP | 9.32 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.67 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|