C19H32O4 — CID 150274664
2-(1,1,1-trimethoxydecan-2-yl)phenol (PubChem CID 150274664) has the molecular formula C19H32O4 and a molecular weight of 324.46 g/mol. Its IUPAC name is 2-(1,1,1-trimethoxydecan-2-yl)phenol.
| Compound Name | 2-(1,1,1-trimethoxydecan-2-yl)phenol |
|---|---|
| PubChem CID | 150274664 |
| Molecular Formula | C19H32O4 |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | 2-(1,1,1-trimethoxydecan-2-yl)phenol |
| SMILES | CCCCCCCCC(c1ccccc1O)C(OC)(OC)OC |
| InChI | InChI=1S/C19H32O4/c1-5-6-7-8-9-10-14-17(19(21-2,22-3)23-4)16-13-11-12-15-18(16)20/h11-13,15,17,20H,5-10,14H2,1-4H3 |
| InChIKey | GEHMYAPRSGDQCC-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|