C25H36O4 — CID 150211853
1-phenoxy-2-(1,1,1-trimethoxydecan-2-yl)benzene (PubChem CID 150211853) has the molecular formula C25H36O4 and a molecular weight of 400.56 g/mol. Its IUPAC name is 1-phenoxy-2-(1,1,1-trimethoxydecan-2-yl)benzene.
| Compound Name | 1-phenoxy-2-(1,1,1-trimethoxydecan-2-yl)benzene |
|---|---|
| PubChem CID | 150211853 |
| Molecular Formula | C25H36O4 |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | 1-phenoxy-2-(1,1,1-trimethoxydecan-2-yl)benzene |
| SMILES | CCCCCCCCC(c1ccccc1Oc1ccccc1)C(OC)(OC)OC |
| InChI | InChI=1S/C25H36O4/c1-5-6-7-8-9-13-19-23(25(26-2,27-3)28-4)22-18-14-15-20-24(22)29-21-16-11-10-12-17-21/h10-12,14-18,20,23H,5-9,13,19H2,1-4H3 |
| InChIKey | FRQUOICCDBRVIL-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|