About 1-cyclopenta-2,4-dien-1-ylhexadecane-1-thiol
1-cyclopenta-2,4-dien-1-ylhexadecane-1-thiol (PubChem CID 154732372) has the molecular formula C21H38S
and a molecular weight of 322.60 g/mol. Its IUPAC name is 1-cyclopenta-2,4-dien-1-ylhexadecane-1-thiol.
Molecular Properties
| Compound Name | 1-cyclopenta-2,4-dien-1-ylhexadecane-1-thiol |
| PubChem CID | 154732372 |
| Molecular Formula | C21H38S |
| Molecular Weight | 322.60 g/mol |
| Exact Mass | 322.27 |
| IUPAC Name | 1-cyclopenta-2,4-dien-1-ylhexadecane-1-thiol |
| SMILES | CCCCCCCCCCCCCCCC(S)C1C=CC=C1 |
| InChI | InChI=1S/C21H38S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-19-21(22)20-17-15-16-18-20/h15-18,20-22H,2-14,19H2,1H3 |
| InChIKey | YHSWMNXGVSDGGN-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 322.60 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclopenta-2,4-dien-1-ylhexadecane-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopenta-2,4-dien-1-ylhexadecane-1-thiol?
The IUPAC name of 1-cyclopenta-2,4-dien-1-ylhexadecane-1-thiol (CID 154732372) is 1-cyclopenta-2,4-dien-1-ylhexadecane-1-thiol.
What is the SMILES notation for 1-cyclopenta-2,4-dien-1-ylhexadecane-1-thiol?
The canonical SMILES for 1-cyclopenta-2,4-dien-1-ylhexadecane-1-thiol is CCCCCCCCCCCCCCCC(S)C1C=CC=C1.
What is the InChIKey of 1-cyclopenta-2,4-dien-1-ylhexadecane-1-thiol?
The InChIKey is YHSWMNXGVSDGGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H38S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-19-21(22)20-17-15-16-18-20/h15-18,20-22H,2-14,19H2,1H3.
What are the key properties of 1-cyclopenta-2,4-dien-1-ylhexadecane-1-thiol?
1-cyclopenta-2,4-dien-1-ylhexadecane-1-thiol has a molecular weight of 322.60 g/mol, XLogP of 7.51, 15 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopenta-2,4-dien-1-ylhexadecane-1-thiol is sourced from PubChem (CID 154732372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).