C16H15F4O3P — CID 58071529
phenyl-(2,2,3,3-tetrafluoro-1-phenylbutoxy)phosphinic acid (PubChem CID 58071529) has the molecular formula C16H15F4O3P and a molecular weight of 362.26 g/mol. Its IUPAC name is phenyl-(2,2,3,3-tetrafluoro-1-phenylbutoxy)phosphinic acid.
| Compound Name | phenyl-(2,2,3,3-tetrafluoro-1-phenylbutoxy)phosphinic acid |
|---|---|
| PubChem CID | 58071529 |
| Molecular Formula | C16H15F4O3P |
| Molecular Weight | 362.26 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | phenyl-(2,2,3,3-tetrafluoro-1-phenylbutoxy)phosphinic acid |
| SMILES | CC(F)(F)C(F)(F)C(OP(=O)(O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H15F4O3P/c1-15(17,18)16(19,20)14(12-8-4-2-5-9-12)23-24(21,22)13-10-6-3-7-11-13/h2-11,14H,1H3,(H,21,22) |
| InChIKey | DCVTURZBVTWCLJ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.26 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|