C22H16F7O5P — CID 3462389
diphenyl [2,2,3,3-tetrafluoro-1-phenyl-3-(trifluoromethoxy)propyl] phosphate (PubChem CID 3462389) has the molecular formula C22H16F7O5P and a molecular weight of 524.33 g/mol. Its IUPAC name is diphenyl [2,2,3,3-tetrafluoro-1-phenyl-3-(trifluoromethoxy)propyl] phosphate.
| Compound Name | diphenyl [2,2,3,3-tetrafluoro-1-phenyl-3-(trifluoromethoxy)propyl] phosphate |
|---|---|
| PubChem CID | 3462389 |
| Molecular Formula | C22H16F7O5P |
| Molecular Weight | 524.33 g/mol |
| Exact Mass | 524.06 |
| IUPAC Name | diphenyl [2,2,3,3-tetrafluoro-1-phenyl-3-(trifluoromethoxy)propyl] phosphate |
| SMILES | O=P(Oc1ccccc1)(Oc1ccccc1)OC(c1ccccc1)C(F)(F)C(F)(F)OC(F)(F)F |
| InChI | InChI=1S/C22H16F7O5P/c23-20(24,21(25,26)34-22(27,28)29)19(16-10-4-1-5-11-16)33-35(30,31-17-12-6-2-7-13-17)32-18-14-8-3-9-15-18/h1-15,19H |
| InChIKey | BQQZYBWBYUCVRB-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.33 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|