C20H15ClF3O4P — CID 3266050
[3-(1-chloro-2,2,2-trifluoroethyl)phenyl] diphenyl phosphate (PubChem CID 3266050) has the molecular formula C20H15ClF3O4P and a molecular weight of 442.76 g/mol. Its IUPAC name is [3-(1-chloro-2,2,2-trifluoroethyl)phenyl] diphenyl phosphate.
| Compound Name | [3-(1-chloro-2,2,2-trifluoroethyl)phenyl] diphenyl phosphate |
|---|---|
| PubChem CID | 3266050 |
| Molecular Formula | C20H15ClF3O4P |
| Molecular Weight | 442.76 g/mol |
| Exact Mass | 442.03 |
| IUPAC Name | [3-(1-chloro-2,2,2-trifluoroethyl)phenyl] diphenyl phosphate |
| SMILES | O=P(Oc1ccccc1)(Oc1ccccc1)Oc1cccc(C(Cl)C(F)(F)F)c1 |
| InChI | InChI=1S/C20H15ClF3O4P/c21-19(20(22,23)24)15-8-7-13-18(14-15)28-29(25,26-16-9-3-1-4-10-16)27-17-11-5-2-6-12-17/h1-14,19H |
| InChIKey | HTNJHEQGWYGACT-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.76 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|