C28H17F18O4P — CID 99683434
bis[(1R)-2,2,3,3,4,4,5,5,5-nonafluoro-1-phenylpentyl] phenyl phosphate (PubChem CID 99683434) has the molecular formula C28H17F18O4P and a molecular weight of 790.38 g/mol. Its IUPAC name is bis[(1R)-2,2,3,3,4,4,5,5,5-nonafluoro-1-phenylpentyl] phenyl phosphate.
| Compound Name | bis[(1R)-2,2,3,3,4,4,5,5,5-nonafluoro-1-phenylpentyl] phenyl phosphate |
|---|---|
| PubChem CID | 99683434 |
| Molecular Formula | C28H17F18O4P |
| Molecular Weight | 790.38 g/mol |
| Exact Mass | 790.06 |
| IUPAC Name | bis[(1R)-2,2,3,3,4,4,5,5,5-nonafluoro-1-phenylpentyl] phenyl phosphate |
| SMILES | O=P(Oc1ccccc1)(O[C@H](c1ccccc1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)O[C@H](c1ccccc1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C28H17F18O4P/c29-21(30,23(33,34)25(37,38)27(41,42)43)19(16-10-4-1-5-11-16)49-51(47,48-18-14-8-3-9-15-18)50-20(17-12-6-2-7-13-17)22(31,32)24(35,36)26(39,40)28(44,45)46/h1-15,19-20H/t19-,20-/m1/s1 |
| InChIKey | YPPNORZEXLOFMQ-WOJBJXKFSA-N |
| XLogP | 11.63 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.38 |
| LogP ≤ 5 | 11.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|