C15H13F4O3P — CID 11864620
1-fluoro-4-[methyl-[(1S)-2,2,2-trifluoro-1-phenylethoxy]phosphoryl]oxybenzene (PubChem CID 11864620) has the molecular formula C15H13F4O3P and a molecular weight of 348.23 g/mol. Its IUPAC name is 1-fluoro-4-[methyl-[(1S)-2,2,2-trifluoro-1-phenylethoxy]phosphoryl]oxybenzene.
| Compound Name | 1-fluoro-4-[methyl-[(1S)-2,2,2-trifluoro-1-phenylethoxy]phosphoryl]oxybenzene |
|---|---|
| PubChem CID | 11864620 |
| Molecular Formula | C15H13F4O3P |
| Molecular Weight | 348.23 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | 1-fluoro-4-[methyl-[(1S)-2,2,2-trifluoro-1-phenylethoxy]phosphoryl]oxybenzene |
| SMILES | C[P@](=O)(Oc1ccc(F)cc1)O[C@@H](c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C15H13F4O3P/c1-23(20,21-13-9-7-12(16)8-10-13)22-14(15(17,18)19)11-5-3-2-4-6-11/h2-10,14H,1H3/t14-,23-/m0/s1 |
| InChIKey | BUDMDBBWFGFZOC-PSLXWICFSA-N |
| XLogP | 5.35 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.23 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|