C9H9ClF3O3P — CID 2249197
[(1R)-1-(3-chlorophenyl)-2,2,2-trifluoroethoxy]-methylphosphinic acid (PubChem CID 2249197) has the molecular formula C9H9ClF3O3P and a molecular weight of 288.59 g/mol. Its IUPAC name is [(1R)-1-(3-chlorophenyl)-2,2,2-trifluoroethoxy]-methylphosphinic acid.
| Compound Name | [(1R)-1-(3-chlorophenyl)-2,2,2-trifluoroethoxy]-methylphosphinic acid |
|---|---|
| PubChem CID | 2249197 |
| Molecular Formula | C9H9ClF3O3P |
| Molecular Weight | 288.59 g/mol |
| Exact Mass | 287.99 |
| IUPAC Name | [(1R)-1-(3-chlorophenyl)-2,2,2-trifluoroethoxy]-methylphosphinic acid |
| SMILES | CP(=O)(O)O[C@H](c1cccc(Cl)c1)C(F)(F)F |
| InChI | InChI=1S/C9H9ClF3O3P/c1-17(14,15)16-8(9(11,12)13)6-3-2-4-7(10)5-6/h2-5,8H,1H3,(H,14,15)/t8-/m1/s1 |
| InChIKey | PREMATQEFWNABR-MRVPVSSYSA-N |
| XLogP | 3.78 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.59 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|