C9H10ClF3NO2P — CID 11864606
1-[(1R)-1-[amino(methyl)phosphoryl]oxy-2,2,2-trifluoroethyl]-4-chlorobenzene (PubChem CID 11864606) has the molecular formula C9H10ClF3NO2P and a molecular weight of 287.61 g/mol. Its IUPAC name is 1-[(1R)-1-[amino(methyl)phosphoryl]oxy-2,2,2-trifluoroethyl]-4-chlorobenzene.
| Compound Name | 1-[(1R)-1-[amino(methyl)phosphoryl]oxy-2,2,2-trifluoroethyl]-4-chlorobenzene |
|---|---|
| PubChem CID | 11864606 |
| Molecular Formula | C9H10ClF3NO2P |
| Molecular Weight | 287.61 g/mol |
| Exact Mass | 287.01 |
| IUPAC Name | 1-[(1R)-1-[amino(methyl)phosphoryl]oxy-2,2,2-trifluoroethyl]-4-chlorobenzene |
| SMILES | C[P@@](N)(=O)O[C@H](c1ccc(Cl)cc1)C(F)(F)F |
| InChI | InChI=1S/C9H10ClF3NO2P/c1-17(14,15)16-8(9(11,12)13)6-2-4-7(10)5-3-6/h2-5,8H,1H3,(H2,14,15)/t8-,17-/m1/s1 |
| InChIKey | UIUMQGRUWJWPRO-CQLKUDPESA-N |
| XLogP | 3.74 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.61 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|