C14H16ClF3O3 — CID 70574673
2-[1-(4-chlorophenyl)-2,2,2-trifluoroethoxy]-2-ethylbutanoic acid (PubChem CID 70574673) has the molecular formula C14H16ClF3O3 and a molecular weight of 324.73 g/mol. Its IUPAC name is 2-[1-(4-chlorophenyl)-2,2,2-trifluoroethoxy]-2-ethylbutanoic acid.
| Compound Name | 2-[1-(4-chlorophenyl)-2,2,2-trifluoroethoxy]-2-ethylbutanoic acid |
|---|---|
| PubChem CID | 70574673 |
| Molecular Formula | C14H16ClF3O3 |
| Molecular Weight | 324.73 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | 2-[1-(4-chlorophenyl)-2,2,2-trifluoroethoxy]-2-ethylbutanoic acid |
| SMILES | CCC(CC)(OC(c1ccc(Cl)cc1)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C14H16ClF3O3/c1-3-13(4-2,12(19)20)21-11(14(16,17)18)9-5-7-10(15)8-6-9/h5-8,11H,3-4H2,1-2H3,(H,19,20) |
| InChIKey | XNJWTSSXFZGQNG-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.73 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |