C10H8ClF3O2 — CID 14113255
[(1R)-2,2,2-trifluoro-1-phenylethyl] 2-chloroacetate (PubChem CID 14113255) has the molecular formula C10H8ClF3O2 and a molecular weight of 252.62 g/mol. Its IUPAC name is [(1R)-2,2,2-trifluoro-1-phenylethyl] 2-chloroacetate.
| Compound Name | [(1R)-2,2,2-trifluoro-1-phenylethyl] 2-chloroacetate |
|---|---|
| PubChem CID | 14113255 |
| Molecular Formula | C10H8ClF3O2 |
| Molecular Weight | 252.62 g/mol |
| Exact Mass | 252.02 |
| IUPAC Name | [(1R)-2,2,2-trifluoro-1-phenylethyl] 2-chloroacetate |
| SMILES | O=C(CCl)O[C@H](c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C10H8ClF3O2/c11-6-8(15)16-9(10(12,13)14)7-4-2-1-3-5-7/h1-5,9H,6H2/t9-/m1/s1 |
| InChIKey | JQRHQUNWTMEVOE-SECBINFHSA-N |
| XLogP | 3.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.62 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|