C13H15F3O3 — CID 57287807
2-(2,2,2-trifluoro-1-phenylethoxy)pentanoic acid (PubChem CID 57287807) has the molecular formula C13H15F3O3 and a molecular weight of 276.25 g/mol. Its IUPAC name is 2-(2,2,2-trifluoro-1-phenylethoxy)pentanoic acid.
| Compound Name | 2-(2,2,2-trifluoro-1-phenylethoxy)pentanoic acid |
|---|---|
| PubChem CID | 57287807 |
| Molecular Formula | C13H15F3O3 |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 2-(2,2,2-trifluoro-1-phenylethoxy)pentanoic acid |
| SMILES | CCCC(OC(c1ccccc1)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C13H15F3O3/c1-2-6-10(12(17)18)19-11(13(14,15)16)9-7-4-3-5-8-9/h3-5,7-8,10-11H,2,6H2,1H3,(H,17,18) |
| InChIKey | CFAMECCZPWWUBV-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |