C15H19F3O4 — CID 56984986
2-[2,2,2-trifluoro-1-(4-methoxyphenyl)ethoxy]hexanoic acid (PubChem CID 56984986) has the molecular formula C15H19F3O4 and a molecular weight of 320.31 g/mol. Its IUPAC name is 2-[2,2,2-trifluoro-1-(4-methoxyphenyl)ethoxy]hexanoic acid.
| Compound Name | 2-[2,2,2-trifluoro-1-(4-methoxyphenyl)ethoxy]hexanoic acid |
|---|---|
| PubChem CID | 56984986 |
| Molecular Formula | C15H19F3O4 |
| Molecular Weight | 320.31 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 2-[2,2,2-trifluoro-1-(4-methoxyphenyl)ethoxy]hexanoic acid |
| SMILES | CCCCC(OC(c1ccc(OC)cc1)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C15H19F3O4/c1-3-4-5-12(14(19)20)22-13(15(16,17)18)10-6-8-11(21-2)9-7-10/h6-9,12-13H,3-5H2,1-2H3,(H,19,20) |
| InChIKey | UHQSKXODPCIZMD-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.31 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |