C21H16Cl2F3O2P — CID 4227058
(2,2-dichloro-1-diphenylphosphoryloxy-3,3,3-trifluoropropyl)benzene (PubChem CID 4227058) has the molecular formula C21H16Cl2F3O2P and a molecular weight of 459.23 g/mol. Its IUPAC name is (2,2-dichloro-1-diphenylphosphoryloxy-3,3,3-trifluoropropyl)benzene.
| Compound Name | (2,2-dichloro-1-diphenylphosphoryloxy-3,3,3-trifluoropropyl)benzene |
|---|---|
| PubChem CID | 4227058 |
| Molecular Formula | C21H16Cl2F3O2P |
| Molecular Weight | 459.23 g/mol |
| Exact Mass | 458.02 |
| IUPAC Name | (2,2-dichloro-1-diphenylphosphoryloxy-3,3,3-trifluoropropyl)benzene |
| SMILES | O=P(OC(c1ccccc1)C(Cl)(Cl)C(F)(F)F)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H16Cl2F3O2P/c22-20(23,21(24,25)26)19(16-10-4-1-5-11-16)28-29(27,17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15,19H |
| InChIKey | HFACVJPUIZAHIO-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.23 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|