C9H6Cl2F4 — CID 14687264
(2,2-dichloro-1,3,3,3-tetrafluoropropyl)benzene (PubChem CID 14687264) has the molecular formula C9H6Cl2F4 and a molecular weight of 261.05 g/mol. Its IUPAC name is (2,2-dichloro-1,3,3,3-tetrafluoropropyl)benzene.
| Compound Name | (2,2-dichloro-1,3,3,3-tetrafluoropropyl)benzene |
|---|---|
| PubChem CID | 14687264 |
| Molecular Formula | C9H6Cl2F4 |
| Molecular Weight | 261.05 g/mol |
| Exact Mass | 259.98 |
| IUPAC Name | (2,2-dichloro-1,3,3,3-tetrafluoropropyl)benzene |
| SMILES | FC(c1ccccc1)C(Cl)(Cl)C(F)(F)F |
| InChI | InChI=1S/C9H6Cl2F4/c10-8(11,9(13,14)15)7(12)6-4-2-1-3-5-6/h1-5,7H |
| InChIKey | XZDKBFQKQIPUAQ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.05 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|