C9H7F5O3S — CID 54168941
1,1,1,2,3-pentafluoro-3-phenylpropane-2-sulfonic acid (PubChem CID 54168941) has the molecular formula C9H7F5O3S and a molecular weight of 290.21 g/mol. Its IUPAC name is 1,1,1,2,3-pentafluoro-3-phenylpropane-2-sulfonic acid.
| Compound Name | 1,1,1,2,3-pentafluoro-3-phenylpropane-2-sulfonic acid |
|---|---|
| PubChem CID | 54168941 |
| Molecular Formula | C9H7F5O3S |
| Molecular Weight | 290.21 g/mol |
| Exact Mass | 290.00 |
| IUPAC Name | 1,1,1,2,3-pentafluoro-3-phenylpropane-2-sulfonic acid |
| SMILES | O=S(=O)(O)C(F)(C(F)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C9H7F5O3S/c10-7(6-4-2-1-3-5-6)8(11,9(12,13)14)18(15,16)17/h1-5,7H,(H,15,16,17) |
| InChIKey | OTQMXAMYVILQAS-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.21 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|