C14H11F6IO6S2 — CID 158041426
(diphenyl-λ3-iodanyl) trifluoromethanesulfonate;trifluoromethanesulfonic acid (PubChem CID 158041426) has the molecular formula C14H11F6IO6S2 and a molecular weight of 580.26 g/mol. Its IUPAC name is (diphenyl-λ3-iodanyl) trifluoromethanesulfonate;trifluoromethanesulfonic acid.
| Compound Name | (diphenyl-λ3-iodanyl) trifluoromethanesulfonate;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 158041426 |
| Molecular Formula | C14H11F6IO6S2 |
| Molecular Weight | 580.26 g/mol |
| Exact Mass | 579.89 |
| IUPAC Name | (diphenyl-λ3-iodanyl) trifluoromethanesulfonate;trifluoromethanesulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)F.O=S(=O)(OI(c1ccccc1)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C13H10F3IO3S.CHF3O3S/c14-13(15,16)21(18,19)20-17(11-7-3-1-4-8-11)12-9-5-2-6-10-12;2-1(3,4)8(5,6)7/h1-10H;(H,5,6,7) |
| InChIKey | FIKACVLECDXTDT-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.26 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|