C28H24F6I2O6S2 — CID 142667561
[(2-methylphenyl)-phenyl-λ3-iodanyl] trifluoromethanesulfonate (PubChem CID 142667561) has the molecular formula C28H24F6I2O6S2 and a molecular weight of 888.42 g/mol. Its IUPAC name is [(2-methylphenyl)-phenyl-λ3-iodanyl] trifluoromethanesulfonate.
| Compound Name | [(2-methylphenyl)-phenyl-λ3-iodanyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 142667561 |
| Molecular Formula | C28H24F6I2O6S2 |
| Molecular Weight | 888.42 g/mol |
| Exact Mass | 887.90 |
| IUPAC Name | [(2-methylphenyl)-phenyl-λ3-iodanyl] trifluoromethanesulfonate |
| SMILES | Cc1ccccc1I(OS(=O)(=O)C(F)(F)F)c1ccccc1.Cc1ccccc1I(OS(=O)(=O)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/2C14H12F3IO3S/c2*1-11-7-5-6-10-13(11)18(12-8-3-2-4-9-12)21-22(19,20)14(15,16)17/h2*2-10H,1H3 |
| InChIKey | IHYZBWFJEARBCD-UHFFFAOYSA-N |
| XLogP | 8.64 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 888.42 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|