C11H7F10IO3S — CID 134930331
[1,1,2,2,3,3,3-heptafluoropropyl-(2-methylphenyl)-λ3-iodanyl] trifluoromethanesulfonate (PubChem CID 134930331) has the molecular formula C11H7F10IO3S and a molecular weight of 536.13 g/mol. Its IUPAC name is [1,1,2,2,3,3,3-heptafluoropropyl-(2-methylphenyl)-λ3-iodanyl] trifluoromethanesulfonate.
| Compound Name | [1,1,2,2,3,3,3-heptafluoropropyl-(2-methylphenyl)-λ3-iodanyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 134930331 |
| Molecular Formula | C11H7F10IO3S |
| Molecular Weight | 536.13 g/mol |
| Exact Mass | 535.90 |
| IUPAC Name | [1,1,2,2,3,3,3-heptafluoropropyl-(2-methylphenyl)-λ3-iodanyl] trifluoromethanesulfonate |
| SMILES | Cc1ccccc1I(OS(=O)(=O)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H7F10IO3S/c1-6-4-2-3-5-7(6)22(25-26(23,24)11(19,20)21)10(17,18)8(12,13)9(14,15)16/h2-5H,1H3 |
| InChIKey | IFNDQGVCXOPIKT-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.13 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|