C27H21F13O3S2 — CID 87483628
[diphenyl-(2,4,6-trimethylphenyl)-λ4-sulfanyl] 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane-1-sulfonate (PubChem CID 87483628) has the molecular formula C27H21F13O3S2 and a molecular weight of 704.57 g/mol. Its IUPAC name is [diphenyl-(2,4,6-trimethylphenyl)-λ4-sulfanyl] 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane-1-sulfonate.
| Compound Name | [diphenyl-(2,4,6-trimethylphenyl)-λ4-sulfanyl] 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane-1-sulfonate |
|---|---|
| PubChem CID | 87483628 |
| Molecular Formula | C27H21F13O3S2 |
| Molecular Weight | 704.57 g/mol |
| Exact Mass | 704.07 |
| IUPAC Name | [diphenyl-(2,4,6-trimethylphenyl)-λ4-sulfanyl] 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane-1-sulfonate |
| SMILES | Cc1cc(C)c(S(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(c2ccccc2)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C27H21F13O3S2/c1-16-14-17(2)21(18(3)15-16)44(19-10-6-4-7-11-19,20-12-8-5-9-13-20)43-45(41,42)27(39,40)25(34,35)23(30,31)22(28,29)24(32,33)26(36,37)38/h4-15H,1-3H3 |
| InChIKey | YUYBNGSYYYXZQG-UHFFFAOYSA-N |
| XLogP | 9.85 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.57 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|