C37H29F9O6S2 — CID 142331758
[[4-[[4-(4-hydroxyphenyl)phenyl]-dimethoxymethyl]phenyl]-diphenyl-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 142331758) has the molecular formula C37H29F9O6S2 and a molecular weight of 804.75 g/mol. Its IUPAC name is [[4-[[4-(4-hydroxyphenyl)phenyl]-dimethoxymethyl]phenyl]-diphenyl-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | [[4-[[4-(4-hydroxyphenyl)phenyl]-dimethoxymethyl]phenyl]-diphenyl-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 142331758 |
| Molecular Formula | C37H29F9O6S2 |
| Molecular Weight | 804.75 g/mol |
| Exact Mass | 804.13 |
| IUPAC Name | [[4-[[4-(4-hydroxyphenyl)phenyl]-dimethoxymethyl]phenyl]-diphenyl-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | COC(OC)(c1ccc(-c2ccc(O)cc2)cc1)c1ccc(S(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C37H29F9O6S2/c1-50-33(51-2,27-17-13-25(14-18-27)26-15-21-29(47)22-16-26)28-19-23-32(24-20-28)53(30-9-5-3-6-10-30,31-11-7-4-8-12-31)52-54(48,49)37(45,46)35(40,41)34(38,39)36(42,43)44/h3-24,47H,1-2H3 |
| InChIKey | GOBUDJRGNUXNCZ-UHFFFAOYSA-N |
| XLogP | 10.52 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.75 |
| LogP ≤ 5 | 10.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|