C28H18F7LiO7S2 — CID 59724390
lithium 1,1,2,2-tetrafluoro-2-[4-[4-[2,2,2-trifluoro-1,1-bis(4-hydroxyphenyl)ethyl]phenyl]phenyl]sulfonylethanesulfonate (PubChem CID 59724390) has the molecular formula C28H18F7LiO7S2 and a molecular weight of 670.51 g/mol. Its IUPAC name is lithium 1,1,2,2-tetrafluoro-2-[4-[4-[2,2,2-trifluoro-1,1-bis(4-hydroxyphenyl)ethyl]phenyl]phenyl]sulfonylethanesulfonate.
| Compound Name | lithium 1,1,2,2-tetrafluoro-2-[4-[4-[2,2,2-trifluoro-1,1-bis(4-hydroxyphenyl)ethyl]phenyl]phenyl]sulfonylethanesulfonate |
|---|---|
| PubChem CID | 59724390 |
| Molecular Formula | C28H18F7LiO7S2 |
| Molecular Weight | 670.51 g/mol |
| Exact Mass | 670.05 |
| IUPAC Name | lithium 1,1,2,2-tetrafluoro-2-[4-[4-[2,2,2-trifluoro-1,1-bis(4-hydroxyphenyl)ethyl]phenyl]phenyl]sulfonylethanesulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)C(F)(F)S(=O)(=O)c1ccc(-c2ccc(C(c3ccc(O)cc3)(c3ccc(O)cc3)C(F)(F)F)cc2)cc1.[Li+] |
| InChI | InChI=1S/C28H19F7O7S2.Li/c29-26(30,31)25(20-7-11-22(36)12-8-20,21-9-13-23(37)14-10-21)19-5-1-17(2-6-19)18-3-15-24(16-4-18)43(38,39)27(32,33)28(34,35)44(40,41)42;/h1-16,36-37H,(H,40,41,42);/q;+1/p-1 |
| InChIKey | OIXMCLDCUIFYJG-UHFFFAOYSA-M |
| XLogP | 3.17 |
| TPSA | 131.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.51 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|