C32H14F26O6S2 — CID 139183804
6-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfonyl)naphthalen-2-ol (PubChem CID 139183804) has the molecular formula C32H14F26O6S2 and a molecular weight of 1052.54 g/mol. Its IUPAC name is 6-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfonyl)naphthalen-2-ol.
| Compound Name | 6-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfonyl)naphthalen-2-ol |
|---|---|
| PubChem CID | 139183804 |
| Molecular Formula | C32H14F26O6S2 |
| Molecular Weight | 1052.54 g/mol |
| Exact Mass | 1051.98 |
| IUPAC Name | 6-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfonyl)naphthalen-2-ol |
| SMILES | O=S(=O)(c1ccc2cc(O)ccc2c1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.O=S(=O)(c1ccc2cc(O)ccc2c1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/2C16H7F13O3S/c2*17-11(18,13(21,22)15(25,26)27)12(19,20)14(23,24)16(28,29)33(31,32)10-4-2-7-5-9(30)3-1-8(7)6-10/h2*1-6,30H |
| InChIKey | NBJPAEFZRYKSBM-UHFFFAOYSA-N |
| XLogP | 12.03 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1052.54 |
| LogP ≤ 5 | 12.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|