C20H14O4S — CID 44562747
2-naphthalen-2-ylsulfonylnaphthalene-1,4-diol (PubChem CID 44562747) has the molecular formula C20H14O4S and a molecular weight of 350.39 g/mol. Its IUPAC name is 2-naphthalen-2-ylsulfonylnaphthalene-1,4-diol.
| Compound Name | 2-naphthalen-2-ylsulfonylnaphthalene-1,4-diol |
|---|---|
| PubChem CID | 44562747 |
| Molecular Formula | C20H14O4S |
| Molecular Weight | 350.39 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | 2-naphthalen-2-ylsulfonylnaphthalene-1,4-diol |
| SMILES | O=S(=O)(c1ccc2ccccc2c1)c1cc(O)c2ccccc2c1O |
| InChI | InChI=1S/C20H14O4S/c21-18-12-19(20(22)17-8-4-3-7-16(17)18)25(23,24)15-10-9-13-5-1-2-6-14(13)11-15/h1-12,21-22H |
| InChIKey | NEXUTBMTXKQNMP-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.39 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|