C30H18F11LiO8S2 — CID 59724397
lithium 1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-[4-[4-[2,2,2-trifluoro-1,1-bis(4-hydroxyphenyl)ethyl]phenyl]phenyl]sulfonylethoxy]ethanesulfonate (PubChem CID 59724397) has the molecular formula C30H18F11LiO8S2 and a molecular weight of 786.52 g/mol. Its IUPAC name is lithium 1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-[4-[4-[2,2,2-trifluoro-1,1-bis(4-hydroxyphenyl)ethyl]phenyl]phenyl]sulfonylethoxy]ethanesulfonate.
| Compound Name | lithium 1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-[4-[4-[2,2,2-trifluoro-1,1-bis(4-hydroxyphenyl)ethyl]phenyl]phenyl]sulfonylethoxy]ethanesulfonate |
|---|---|
| PubChem CID | 59724397 |
| Molecular Formula | C30H18F11LiO8S2 |
| Molecular Weight | 786.52 g/mol |
| Exact Mass | 786.04 |
| IUPAC Name | lithium 1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-[4-[4-[2,2,2-trifluoro-1,1-bis(4-hydroxyphenyl)ethyl]phenyl]phenyl]sulfonylethoxy]ethanesulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)C(F)(F)OC(F)(F)C(F)(F)S(=O)(=O)c1ccc(-c2ccc(C(c3ccc(O)cc3)(c3ccc(O)cc3)C(F)(F)F)cc2)cc1.[Li+] |
| InChI | InChI=1S/C30H19F11O8S2.Li/c31-26(32,33)25(20-7-11-22(42)12-8-20,21-9-13-23(43)14-10-21)19-5-1-17(2-6-19)18-3-15-24(16-4-18)50(44,45)29(38,39)27(34,35)49-28(36,37)30(40,41)51(46,47)48;/h1-16,42-43H,(H,46,47,48);/q;+1/p-1 |
| InChIKey | WOPUAUKDXSXBDI-UHFFFAOYSA-M |
| XLogP | 4.37 |
| TPSA | 141.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.52 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|