C14H13F11O3S2 — CID 139975045
[benzyl(dimethyl)-λ4-sulfanyl] 1,1,2,2,3,3,4,4,5,5,5-undecafluoropentane-1-sulfonate (PubChem CID 139975045) has the molecular formula C14H13F11O3S2 and a molecular weight of 502.37 g/mol. Its IUPAC name is [benzyl(dimethyl)-λ4-sulfanyl] 1,1,2,2,3,3,4,4,5,5,5-undecafluoropentane-1-sulfonate.
| Compound Name | [benzyl(dimethyl)-λ4-sulfanyl] 1,1,2,2,3,3,4,4,5,5,5-undecafluoropentane-1-sulfonate |
|---|---|
| PubChem CID | 139975045 |
| Molecular Formula | C14H13F11O3S2 |
| Molecular Weight | 502.37 g/mol |
| Exact Mass | 502.01 |
| IUPAC Name | [benzyl(dimethyl)-λ4-sulfanyl] 1,1,2,2,3,3,4,4,5,5,5-undecafluoropentane-1-sulfonate |
| SMILES | CS(C)(Cc1ccccc1)OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H13F11O3S2/c1-29(2,8-9-6-4-3-5-7-9)28-30(26,27)14(24,25)12(19,20)10(15,16)11(17,18)13(21,22)23/h3-7H,8H2,1-2H3 |
| InChIKey | QMFDDBVLGMTUFE-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.37 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|