C13H12BrF9O3S2 — CID 139975004
[(4-bromophenyl)methyl-dimethyl-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 139975004) has the molecular formula C13H12BrF9O3S2 and a molecular weight of 531.26 g/mol. Its IUPAC name is [(4-bromophenyl)methyl-dimethyl-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | [(4-bromophenyl)methyl-dimethyl-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 139975004 |
| Molecular Formula | C13H12BrF9O3S2 |
| Molecular Weight | 531.26 g/mol |
| Exact Mass | 529.93 |
| IUPAC Name | [(4-bromophenyl)methyl-dimethyl-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | CS(C)(Cc1ccc(Br)cc1)OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H12BrF9O3S2/c1-27(2,7-8-3-5-9(14)6-4-8)26-28(24,25)13(22,23)11(17,18)10(15,16)12(19,20)21/h3-6H,7H2,1-2H3 |
| InChIKey | GOMUOEZNDVPZAE-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.26 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|