C13H12F10O3S2 — CID 139975080
[dimethyl-[[4-(trifluoromethyl)phenyl]methyl]-λ4-sulfanyl] 1,1,2,2,3,3,3-heptafluoropropane-1-sulfonate (PubChem CID 139975080) has the molecular formula C13H12F10O3S2 and a molecular weight of 470.35 g/mol. Its IUPAC name is [dimethyl-[[4-(trifluoromethyl)phenyl]methyl]-λ4-sulfanyl] 1,1,2,2,3,3,3-heptafluoropropane-1-sulfonate.
| Compound Name | [dimethyl-[[4-(trifluoromethyl)phenyl]methyl]-λ4-sulfanyl] 1,1,2,2,3,3,3-heptafluoropropane-1-sulfonate |
|---|---|
| PubChem CID | 139975080 |
| Molecular Formula | C13H12F10O3S2 |
| Molecular Weight | 470.35 g/mol |
| Exact Mass | 470.01 |
| IUPAC Name | [dimethyl-[[4-(trifluoromethyl)phenyl]methyl]-λ4-sulfanyl] 1,1,2,2,3,3,3-heptafluoropropane-1-sulfonate |
| SMILES | CS(C)(Cc1ccc(C(F)(F)F)cc1)OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H12F10O3S2/c1-27(2,7-8-3-5-9(6-4-8)10(14,15)16)26-28(24,25)13(22,23)11(17,18)12(19,20)21/h3-6H,7H2,1-2H3 |
| InChIKey | WNWSLEHBCJNXTJ-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.35 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|