About 1-(trifluoromethyl)-4-(3,3,3-trifluoropropylsulfonylmethyl)benzene
1-(trifluoromethyl)-4-(3,3,3-trifluoropropylsulfonylmethyl)benzene (PubChem CID 86059305) has the molecular formula C11H10F6O2S
and a molecular weight of 320.25 g/mol. Its IUPAC name is 1-(trifluoromethyl)-4-(3,3,3-trifluoropropylsulfonylmethyl)benzene.
Molecular Properties
| Compound Name | 1-(trifluoromethyl)-4-(3,3,3-trifluoropropylsulfonylmethyl)benzene |
| PubChem CID | 86059305 |
| Molecular Formula | C11H10F6O2S |
| Molecular Weight | 320.25 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | 1-(trifluoromethyl)-4-(3,3,3-trifluoropropylsulfonylmethyl)benzene |
| SMILES | O=S(=O)(CCC(F)(F)F)Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H10F6O2S/c12-10(13,14)5-6-20(18,19)7-8-1-3-9(4-2-8)11(15,16)17/h1-4H,5-7H2 |
| InChIKey | JBSPSKNKTJEWAB-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.25 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(trifluoromethyl)-4-(3,3,3-trifluoropropylsulfonylmethyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(trifluoromethyl)-4-(3,3,3-trifluoropropylsulfonylmethyl)benzene?
The IUPAC name of 1-(trifluoromethyl)-4-(3,3,3-trifluoropropylsulfonylmethyl)benzene (CID 86059305) is 1-(trifluoromethyl)-4-(3,3,3-trifluoropropylsulfonylmethyl)benzene.
What is the SMILES notation for 1-(trifluoromethyl)-4-(3,3,3-trifluoropropylsulfonylmethyl)benzene?
The canonical SMILES for 1-(trifluoromethyl)-4-(3,3,3-trifluoropropylsulfonylmethyl)benzene is O=S(=O)(CCC(F)(F)F)Cc1ccc(C(F)(F)F)cc1.
What is the InChIKey of 1-(trifluoromethyl)-4-(3,3,3-trifluoropropylsulfonylmethyl)benzene?
The InChIKey is JBSPSKNKTJEWAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10F6O2S/c12-10(13,14)5-6-20(18,19)7-8-1-3-9(4-2-8)11(15,16)17/h1-4H,5-7H2.
What are the key properties of 1-(trifluoromethyl)-4-(3,3,3-trifluoropropylsulfonylmethyl)benzene?
1-(trifluoromethyl)-4-(3,3,3-trifluoropropylsulfonylmethyl)benzene has a molecular weight of 320.25 g/mol, XLogP of 3.57, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(trifluoromethyl)-4-(3,3,3-trifluoropropylsulfonylmethyl)benzene is sourced from PubChem (CID 86059305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).