C8H7F3O3S — CID 162617570
dideuterio-[4-(trifluoromethyl)phenyl]methanesulfonic acid (PubChem CID 162617570) has the molecular formula C8H7F3O3S and a molecular weight of 242.21 g/mol. Its IUPAC name is dideuterio-[4-(trifluoromethyl)phenyl]methanesulfonic acid.
| Compound Name | dideuterio-[4-(trifluoromethyl)phenyl]methanesulfonic acid |
|---|---|
| PubChem CID | 162617570 |
| Molecular Formula | C8H7F3O3S |
| Molecular Weight | 242.21 g/mol |
| Exact Mass | 242.02 |
| IUPAC Name | dideuterio-[4-(trifluoromethyl)phenyl]methanesulfonic acid |
| SMILES | [2H]C([2H])(c1ccc(C(F)(F)F)cc1)S(=O)(=O)O |
| InChI | InChI=1S/C8H7F3O3S/c9-8(10,11)7-3-1-6(2-4-7)5-15(12,13)14/h1-4H,5H2,(H,12,13,14)/i5D2 |
| InChIKey | ONOVHOSDVZXEJE-BFWBPSQCSA-N |
| XLogP | 2.09 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.21 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|