C9H10F3NO2S — CID 4637501
N-[[4-(trifluoromethyl)phenyl]methyl]methanesulfonamide (PubChem CID 4637501) has the molecular formula C9H10F3NO2S and a molecular weight of 253.25 g/mol. Its IUPAC name is N-[[4-(trifluoromethyl)phenyl]methyl]methanesulfonamide.
| Compound Name | N-[[4-(trifluoromethyl)phenyl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 4637501 |
| Molecular Formula | C9H10F3NO2S |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.04 |
| IUPAC Name | N-[[4-(trifluoromethyl)phenyl]methyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C9H10F3NO2S/c1-16(14,15)13-6-7-2-4-8(5-3-7)9(10,11)12/h2-5,13H,6H2,1H3 |
| InChIKey | QLVCHFPCCXVIDH-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |