C14H10Cl2F3NO2S — CID 3332822
2,4-dichloro-N-[[4-(trifluoromethyl)phenyl]methyl]benzenesulfonamide (PubChem CID 3332822) has the molecular formula C14H10Cl2F3NO2S and a molecular weight of 384.21 g/mol. Its IUPAC name is 2,4-dichloro-N-[[4-(trifluoromethyl)phenyl]methyl]benzenesulfonamide.
| Compound Name | 2,4-dichloro-N-[[4-(trifluoromethyl)phenyl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 3332822 |
| Molecular Formula | C14H10Cl2F3NO2S |
| Molecular Weight | 384.21 g/mol |
| Exact Mass | 382.98 |
| IUPAC Name | 2,4-dichloro-N-[[4-(trifluoromethyl)phenyl]methyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCc1ccc(C(F)(F)F)cc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H10Cl2F3NO2S/c15-11-5-6-13(12(16)7-11)23(21,22)20-8-9-1-3-10(4-2-9)14(17,18)19/h1-7,20H,8H2 |
| InChIKey | SNWHOVBPCZAOLK-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.21 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |