About CID 70601747
CID 70601747 (PubChem CID 70601747) has the molecular formula C8H11NNaO2S
and a molecular weight of 208.24 g/mol.
Molecular Properties
| Compound Name | CID 70601747 |
| PubChem CID | 70601747 |
| Molecular Formula | C8H11NNaO2S |
| Molecular Weight | 208.24 g/mol |
| Exact Mass | 208.04 |
| IUPAC Name | — |
| SMILES | CS(=O)(=O)NCc1ccccc1.[Na] |
| InChI | InChI=1S/C8H11NO2S.Na/c1-12(10,11)9-7-8-5-3-2-4-6-8;/h2-6,9H,7H2,1H3; |
| InChIKey | NVRITSQOSGYYSZ-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.24 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 70601747 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 70601747?
The IUPAC name of CID 70601747 (CID 70601747) is not available.
What is the SMILES notation for CID 70601747?
The canonical SMILES for CID 70601747 is CS(=O)(=O)NCc1ccccc1.[Na].
What is the InChIKey of CID 70601747?
The InChIKey is NVRITSQOSGYYSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO2S.Na/c1-12(10,11)9-7-8-5-3-2-4-6-8;/h2-6,9H,7H2,1H3;.
What are the key properties of CID 70601747?
CID 70601747 has a molecular weight of 208.24 g/mol, XLogP of 0.35, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 70601747 is sourced from PubChem (CID 70601747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).