About sodium N-benzylsulfamate
sodium N-benzylsulfamate (PubChem CID 23702294) has the molecular formula C7H8NNaO3S
and a molecular weight of 209.20 g/mol. Its IUPAC name is sodium N-benzylsulfamate.
Molecular Properties
| Compound Name | sodium N-benzylsulfamate |
| PubChem CID | 23702294 |
| Molecular Formula | C7H8NNaO3S |
| Molecular Weight | 209.20 g/mol |
| Exact Mass | 209.01 |
| IUPAC Name | sodium N-benzylsulfamate |
| SMILES | O=S(=O)([O-])NCc1ccccc1.[Na+] |
| InChI | InChI=1S/C7H9NO3S.Na/c9-12(10,11)8-6-7-4-2-1-3-5-7;/h1-5,8H,6H2,(H,9,10,11);/q;+1/p-1 |
| InChIKey | HLXDLLTZCHINKX-UHFFFAOYSA-M |
| XLogP | -2.76 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.20 |
| LogP ≤ 5 | -2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium N-benzylsulfamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium N-benzylsulfamate?
The IUPAC name of sodium N-benzylsulfamate (CID 23702294) is sodium N-benzylsulfamate.
What is the SMILES notation for sodium N-benzylsulfamate?
The canonical SMILES for sodium N-benzylsulfamate is O=S(=O)([O-])NCc1ccccc1.[Na+].
What is the InChIKey of sodium N-benzylsulfamate?
The InChIKey is HLXDLLTZCHINKX-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H9NO3S.Na/c9-12(10,11)8-6-7-4-2-1-3-5-7;/h1-5,8H,6H2,(H,9,10,11);/q;+1/p-1.
What are the key properties of sodium N-benzylsulfamate?
sodium N-benzylsulfamate has a molecular weight of 209.20 g/mol, XLogP of -2.76, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium N-benzylsulfamate is sourced from PubChem (CID 23702294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).