C10H15N2O4S- — CID 171979162
N-[3-(benzylamino)-2-hydroxypropyl]sulfamate (PubChem CID 171979162) has the molecular formula C10H15N2O4S- and a molecular weight of 259.31 g/mol. Its IUPAC name is N-[3-(benzylamino)-2-hydroxypropyl]sulfamate.
| Compound Name | N-[3-(benzylamino)-2-hydroxypropyl]sulfamate |
|---|---|
| PubChem CID | 171979162 |
| Molecular Formula | C10H15N2O4S- |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | N-[3-(benzylamino)-2-hydroxypropyl]sulfamate |
| SMILES | O=S(=O)([O-])NCC(O)CNCc1ccccc1 |
| InChI | InChI=1S/C10H16N2O4S/c13-10(8-12-17(14,15)16)7-11-6-9-4-2-1-3-5-9/h1-5,10-13H,6-8H2,(H,14,15,16)/p-1 |
| InChIKey | SZJHJEPILXXORP-UHFFFAOYSA-M |
| XLogP | -0.81 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|