C20H29N3O3S — CID 56995576
(2R)-1-[[1-(4-aminophenyl)sulfonyl-2-methylpropyl]amino]-3-(benzylamino)propan-2-ol (PubChem CID 56995576) has the molecular formula C20H29N3O3S and a molecular weight of 391.54 g/mol. Its IUPAC name is (2R)-1-[[1-(4-aminophenyl)sulfonyl-2-methylpropyl]amino]-3-(benzylamino)propan-2-ol.
| Compound Name | (2R)-1-[[1-(4-aminophenyl)sulfonyl-2-methylpropyl]amino]-3-(benzylamino)propan-2-ol |
|---|---|
| PubChem CID | 56995576 |
| Molecular Formula | C20H29N3O3S |
| Molecular Weight | 391.54 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | (2R)-1-[[1-(4-aminophenyl)sulfonyl-2-methylpropyl]amino]-3-(benzylamino)propan-2-ol |
| SMILES | CC(C)C(NC[C@H](O)CNCc1ccccc1)S(=O)(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C20H29N3O3S/c1-15(2)20(27(25,26)19-10-8-17(21)9-11-19)23-14-18(24)13-22-12-16-6-4-3-5-7-16/h3-11,15,18,20,22-24H,12-14,21H2,1-2H3/t18-,20?/m1/s1 |
| InChIKey | FFEULEQCIQXMSC-QSVWIEALSA-N |
| XLogP | 1.76 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.54 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|