C16H19F9O3S2 — CID 139974852
[dimethyl-[(4-propan-2-ylphenyl)methyl]-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 139974852) has the molecular formula C16H19F9O3S2 and a molecular weight of 494.44 g/mol. Its IUPAC name is [dimethyl-[(4-propan-2-ylphenyl)methyl]-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | [dimethyl-[(4-propan-2-ylphenyl)methyl]-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 139974852 |
| Molecular Formula | C16H19F9O3S2 |
| Molecular Weight | 494.44 g/mol |
| Exact Mass | 494.06 |
| IUPAC Name | [dimethyl-[(4-propan-2-ylphenyl)methyl]-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | CC(C)c1ccc(CS(C)(C)OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H19F9O3S2/c1-10(2)12-7-5-11(6-8-12)9-29(3,4)28-30(26,27)16(24,25)14(19,20)13(17,18)15(21,22)23/h5-8,10H,9H2,1-4H3 |
| InChIKey | CDEBGKOUUQXHGK-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.44 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|