C15H23F3O5S2 — CID 139752569
[bis(2-hydroxyethyl)-[(4-propan-2-ylphenyl)methyl]-λ4-sulfanyl] trifluoromethanesulfonate (PubChem CID 139752569) has the molecular formula C15H23F3O5S2 and a molecular weight of 404.47 g/mol. Its IUPAC name is [bis(2-hydroxyethyl)-[(4-propan-2-ylphenyl)methyl]-λ4-sulfanyl] trifluoromethanesulfonate.
| Compound Name | [bis(2-hydroxyethyl)-[(4-propan-2-ylphenyl)methyl]-λ4-sulfanyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 139752569 |
| Molecular Formula | C15H23F3O5S2 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | [bis(2-hydroxyethyl)-[(4-propan-2-ylphenyl)methyl]-λ4-sulfanyl] trifluoromethanesulfonate |
| SMILES | CC(C)c1ccc(CS(CCO)(CCO)OS(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H23F3O5S2/c1-12(2)14-5-3-13(4-6-14)11-24(9-7-19,10-8-20)23-25(21,22)15(16,17)18/h3-6,12,19-20H,7-11H2,1-2H3 |
| InChIKey | AGYAZMJRUIOJOI-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|