C19H26O5S2 — CID 139752908
[bis(2-hydroxyethyl)-[(4-methylphenyl)methyl]-λ4-sulfanyl] 4-methylbenzenesulfonate (PubChem CID 139752908) has the molecular formula C19H26O5S2 and a molecular weight of 398.55 g/mol. Its IUPAC name is [bis(2-hydroxyethyl)-[(4-methylphenyl)methyl]-λ4-sulfanyl] 4-methylbenzenesulfonate.
| Compound Name | [bis(2-hydroxyethyl)-[(4-methylphenyl)methyl]-λ4-sulfanyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 139752908 |
| Molecular Formula | C19H26O5S2 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | [bis(2-hydroxyethyl)-[(4-methylphenyl)methyl]-λ4-sulfanyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(CS(CCO)(CCO)OS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C19H26O5S2/c1-16-3-7-18(8-4-16)15-25(13-11-20,14-12-21)24-26(22,23)19-9-5-17(2)6-10-19/h3-10,20-21H,11-15H2,1-2H3 |
| InChIKey | VYBNXXSUTYZUNS-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |