About (4-methylphenyl)sulfonyl sulfate
(4-methylphenyl)sulfonyl sulfate (PubChem CID 23103740) has the molecular formula C7H7O6S2-
and a molecular weight of 251.26 g/mol. Its IUPAC name is (4-methylphenyl)sulfonyl sulfate.
Molecular Properties
| Compound Name | (4-methylphenyl)sulfonyl sulfate |
| PubChem CID | 23103740 |
| Molecular Formula | C7H7O6S2- |
| Molecular Weight | 251.26 g/mol |
| Exact Mass | 250.97 |
| IUPAC Name | (4-methylphenyl)sulfonyl sulfate |
| SMILES | Cc1ccc(S(=O)(=O)OS(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C7H8O6S2/c1-6-2-4-7(5-3-6)14(8,9)13-15(10,11)12/h2-5H,1H3,(H,10,11,12)/p-1 |
| InChIKey | RLYXFYKZPNHYCO-UHFFFAOYSA-M |
| XLogP | 0.16 |
| TPSA | 100.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.26 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze (4-methylphenyl)sulfonyl sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methylphenyl)sulfonyl sulfate?
The IUPAC name of (4-methylphenyl)sulfonyl sulfate (CID 23103740) is (4-methylphenyl)sulfonyl sulfate.
What is the SMILES notation for (4-methylphenyl)sulfonyl sulfate?
The canonical SMILES for (4-methylphenyl)sulfonyl sulfate is Cc1ccc(S(=O)(=O)OS(=O)(=O)[O-])cc1.
What is the InChIKey of (4-methylphenyl)sulfonyl sulfate?
The InChIKey is RLYXFYKZPNHYCO-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H8O6S2/c1-6-2-4-7(5-3-6)14(8,9)13-15(10,11)12/h2-5H,1H3,(H,10,11,12)/p-1.
What are the key properties of (4-methylphenyl)sulfonyl sulfate?
(4-methylphenyl)sulfonyl sulfate has a molecular weight of 251.26 g/mol, XLogP of 0.16, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methylphenyl)sulfonyl sulfate is sourced from PubChem (CID 23103740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).